C15H21NO4S — CID 134403373
benzyl 3-(cyclopropylsulfonylamino)-2,2-dimethylpropanoate (PubChem CID 134403373) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is benzyl 3-(cyclopropylsulfonylamino)-2,2-dimethylpropanoate.
| Compound Name | benzyl 3-(cyclopropylsulfonylamino)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134403373 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | benzyl 3-(cyclopropylsulfonylamino)-2,2-dimethylpropanoate |
| SMILES | CC(C)(CNS(=O)(=O)C1CC1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H21NO4S/c1-15(2,11-16-21(18,19)13-8-9-13)14(17)20-10-12-6-4-3-5-7-12/h3-7,13,16H,8-11H2,1-2H3 |
| InChIKey | YISBQGNWVNLAJT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |