C12H17IN2 — CID 134406370
2-iodo-5-[[(3S,4R)-3-methylpiperidin-4-yl]methyl]pyridine (PubChem CID 134406370) has the molecular formula C12H17IN2 and a molecular weight of 316.19 g/mol. Its IUPAC name is 2-iodo-5-[[(3S,4R)-3-methylpiperidin-4-yl]methyl]pyridine.
| Compound Name | 2-iodo-5-[[(3S,4R)-3-methylpiperidin-4-yl]methyl]pyridine |
|---|---|
| PubChem CID | 134406370 |
| Molecular Formula | C12H17IN2 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 2-iodo-5-[[(3S,4R)-3-methylpiperidin-4-yl]methyl]pyridine |
| SMILES | C[C@@H]1CNCC[C@H]1Cc1ccc(I)nc1 |
| InChI | InChI=1S/C12H17IN2/c1-9-7-14-5-4-11(9)6-10-2-3-12(13)15-8-10/h2-3,8-9,11,14H,4-7H2,1H3/t9-,11+/m1/s1 |
| InChIKey | XHBUEJQWQQJUKR-KOLCDFICSA-N |
| XLogP | 2.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|