C13H19N3 — CID 134406396
7-(2-pyridin-3-ylethyl)-4,7-diazaspiro[2.5]octane (PubChem CID 134406396) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 7-(2-pyridin-3-ylethyl)-4,7-diazaspiro[2.5]octane.
| Compound Name | 7-(2-pyridin-3-ylethyl)-4,7-diazaspiro[2.5]octane |
|---|---|
| PubChem CID | 134406396 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 7-(2-pyridin-3-ylethyl)-4,7-diazaspiro[2.5]octane |
| SMILES | c1cncc(CCN2CCNC3(CC3)C2)c1 |
| InChI | InChI=1S/C13H19N3/c1-2-12(10-14-6-1)3-8-16-9-7-15-13(11-16)4-5-13/h1-2,6,10,15H,3-5,7-9,11H2 |
| InChIKey | WQOITRJIFBGFAO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |