C29H40ClN3O5 — CID 134410102
2-[(2S,3S,4R)-4-butoxy-1-[4-[(3R,4R)-1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-3-methylpyrrolidin-2-yl]acetic acid (PubChem CID 134410102) has the molecular formula C29H40ClN3O5 and a molecular weight of 546.11 g/mol. Its IUPAC name is 2-[(2S,3S,4R)-4-butoxy-1-[4-[(3R,4R)-1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-3-methylpyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[(2S,3S,4R)-4-butoxy-1-[4-[(3R,4R)-1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-3-methylpyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 134410102 |
| Molecular Formula | C29H40ClN3O5 |
| Molecular Weight | 546.11 g/mol |
| Exact Mass | 545.27 |
| IUPAC Name | 2-[(2S,3S,4R)-4-butoxy-1-[4-[(3R,4R)-1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-3-methylpyrrolidin-2-yl]acetic acid |
| SMILES | CCCCO[C@H]1CN(c2ccc(O[C@@H]3CCN(c4cc(OC)ncc4Cl)C[C@H]3C)cc2)[C@@H](CC(=O)O)[C@@H]1C |
| InChI | InChI=1S/C29H40ClN3O5/c1-5-6-13-37-27-18-33(24(20(27)3)15-29(34)35)21-7-9-22(10-8-21)38-26-11-12-32(17-19(26)2)25-14-28(36-4)31-16-23(25)30/h7-10,14,16,19-20,24,26-27H,5-6,11-13,15,17-18H2,1-4H3,(H,34,35)/t19-,20+,24+,26-,27+/m1/s1 |
| InChIKey | MSJSWRFGNLAKMZ-UAVGYUILSA-N |
| XLogP | 5.52 |
| TPSA | 84.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.11 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|