C12H15ClN2O — CID 134410251
1-(5-chloro-1H-indazol-7-yl)-2,2-dimethylpropan-1-ol (PubChem CID 134410251) has the molecular formula C12H15ClN2O and a molecular weight of 238.72 g/mol. Its IUPAC name is 1-(5-chloro-1H-indazol-7-yl)-2,2-dimethylpropan-1-ol.
| Compound Name | 1-(5-chloro-1H-indazol-7-yl)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 134410251 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 1-(5-chloro-1H-indazol-7-yl)-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(C)C(O)c1cc(Cl)cc2cn[nH]c12 |
| InChI | InChI=1S/C12H15ClN2O/c1-12(2,3)11(16)9-5-8(13)4-7-6-14-15-10(7)9/h4-6,11,16H,1-3H3,(H,14,15) |
| InChIKey | ICMXIBSKSJJKDA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |