C13H14ClFN2O — CID 161390872
(5-chloro-1H-indazol-7-yl)-(3-fluoro-3-methylcyclobutyl)methanol (PubChem CID 161390872) has the molecular formula C13H14ClFN2O and a molecular weight of 268.72 g/mol. Its IUPAC name is (5-chloro-1H-indazol-7-yl)-(3-fluoro-3-methylcyclobutyl)methanol.
| Compound Name | (5-chloro-1H-indazol-7-yl)-(3-fluoro-3-methylcyclobutyl)methanol |
|---|---|
| PubChem CID | 161390872 |
| Molecular Formula | C13H14ClFN2O |
| Molecular Weight | 268.72 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | (5-chloro-1H-indazol-7-yl)-(3-fluoro-3-methylcyclobutyl)methanol |
| SMILES | CC1(F)CC(C(O)c2cc(Cl)cc3cn[nH]c23)C1 |
| InChI | InChI=1S/C13H14ClFN2O/c1-13(15)4-8(5-13)12(18)10-3-9(14)2-7-6-16-17-11(7)10/h2-3,6,8,12,18H,4-5H2,1H3,(H,16,17) |
| InChIKey | KABDGFAXJJAZJK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.72 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |