C17H22ClN3O3S — CID 134373913
1-(5-chloro-1H-indazol-7-yl)-2-(3-methylsulfonyl-3-azabicyclo[3.2.1]octan-8-yl)ethanol (PubChem CID 134373913) has the molecular formula C17H22ClN3O3S and a molecular weight of 383.90 g/mol. Its IUPAC name is 1-(5-chloro-1H-indazol-7-yl)-2-(3-methylsulfonyl-3-azabicyclo[3.2.1]octan-8-yl)ethanol.
| Compound Name | 1-(5-chloro-1H-indazol-7-yl)-2-(3-methylsulfonyl-3-azabicyclo[3.2.1]octan-8-yl)ethanol |
|---|---|
| PubChem CID | 134373913 |
| Molecular Formula | C17H22ClN3O3S |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 1-(5-chloro-1H-indazol-7-yl)-2-(3-methylsulfonyl-3-azabicyclo[3.2.1]octan-8-yl)ethanol |
| SMILES | CS(=O)(=O)N1CC2CCC(C1)C2CC(O)c1cc(Cl)cc2cn[nH]c12 |
| InChI | InChI=1S/C17H22ClN3O3S/c1-25(23,24)21-8-10-2-3-11(9-21)14(10)6-16(22)15-5-13(18)4-12-7-19-20-17(12)15/h4-5,7,10-11,14,16,22H,2-3,6,8-9H2,1H3,(H,19,20) |
| InChIKey | CAHUQCQXOSMPFI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |