C14H17ClF2N4O3S — CID 140857285
N-[2-(5-chloro-1H-indazol-7-yl)-1,1-difluoro-2-hydroxyethyl]piperidine-1-sulfonamide (PubChem CID 140857285) has the molecular formula C14H17ClF2N4O3S and a molecular weight of 394.83 g/mol. Its IUPAC name is N-[2-(5-chloro-1H-indazol-7-yl)-1,1-difluoro-2-hydroxyethyl]piperidine-1-sulfonamide.
| Compound Name | N-[2-(5-chloro-1H-indazol-7-yl)-1,1-difluoro-2-hydroxyethyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 140857285 |
| Molecular Formula | C14H17ClF2N4O3S |
| Molecular Weight | 394.83 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | N-[2-(5-chloro-1H-indazol-7-yl)-1,1-difluoro-2-hydroxyethyl]piperidine-1-sulfonamide |
| SMILES | O=S(=O)(NC(F)(F)C(O)c1cc(Cl)cc2cn[nH]c12)N1CCCCC1 |
| InChI | InChI=1S/C14H17ClF2N4O3S/c15-10-6-9-8-18-19-12(9)11(7-10)13(22)14(16,17)20-25(23,24)21-4-2-1-3-5-21/h6-8,13,20,22H,1-5H2,(H,18,19) |
| InChIKey | DXCAFVFVOBLGGM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.83 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|