C19H21F3N6O4S — CID 134410443
1-[5-ethylsulfonyl-6-[3-methyl-6-(trifluoromethyl)imidazo[4,5-c]pyridin-2-yl]-2-pyridinyl]-3-(2-methoxyethyl)urea (PubChem CID 134410443) has the molecular formula C19H21F3N6O4S and a molecular weight of 486.48 g/mol. Its IUPAC name is 1-[5-ethylsulfonyl-6-[3-methyl-6-(trifluoromethyl)imidazo[4,5-c]pyridin-2-yl]-2-pyridinyl]-3-(2-methoxyethyl)urea.
| Compound Name | 1-[5-ethylsulfonyl-6-[3-methyl-6-(trifluoromethyl)imidazo[4,5-c]pyridin-2-yl]-2-pyridinyl]-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 134410443 |
| Molecular Formula | C19H21F3N6O4S |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 1-[5-ethylsulfonyl-6-[3-methyl-6-(trifluoromethyl)imidazo[4,5-c]pyridin-2-yl]-2-pyridinyl]-3-(2-methoxyethyl)urea |
| SMILES | CCS(=O)(=O)c1ccc(NC(=O)NCCOC)nc1-c1nc2cc(C(F)(F)F)ncc2n1C |
| InChI | InChI=1S/C19H21F3N6O4S/c1-4-33(30,31)13-5-6-15(27-18(29)23-7-8-32-3)26-16(13)17-25-11-9-14(19(20,21)22)24-10-12(11)28(17)2/h5-6,9-10H,4,7-8H2,1-3H3,(H2,23,26,27,29) |
| InChIKey | NPHVDTXXJMOTTF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|