C19H25ClN4O2 — CID 134411463
4-[(6R)-9-chloro-6-hydroxy-5-methyl-3,4-diazatricyclo[5.3.1.04,11]undeca-1(11),2,7,9-tetraen-5-yl]-N-propan-2-ylpiperidine-1-carboxamide (PubChem CID 134411463) has the molecular formula C19H25ClN4O2 and a molecular weight of 376.89 g/mol. Its IUPAC name is 4-[(6R)-9-chloro-6-hydroxy-5-methyl-3,4-diazatricyclo[5.3.1.04,11]undeca-1(11),2,7,9-tetraen-5-yl]-N-propan-2-ylpiperidine-1-carboxamide.
| Compound Name | 4-[(6R)-9-chloro-6-hydroxy-5-methyl-3,4-diazatricyclo[5.3.1.04,11]undeca-1(11),2,7,9-tetraen-5-yl]-N-propan-2-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 134411463 |
| Molecular Formula | C19H25ClN4O2 |
| Molecular Weight | 376.89 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 4-[(6R)-9-chloro-6-hydroxy-5-methyl-3,4-diazatricyclo[5.3.1.04,11]undeca-1(11),2,7,9-tetraen-5-yl]-N-propan-2-ylpiperidine-1-carboxamide |
| SMILES | CC(C)NC(=O)N1CCC(C2(C)[C@H](O)c3cc(Cl)cc4cnn2c34)CC1 |
| InChI | InChI=1S/C19H25ClN4O2/c1-11(2)22-18(26)23-6-4-13(5-7-23)19(3)17(25)15-9-14(20)8-12-10-21-24(19)16(12)15/h8-11,13,17,25H,4-7H2,1-3H3,(H,22,26)/t17-,19?/m1/s1 |
| InChIKey | DLPWKLDLQCDQKX-DUSLRRAJSA-N |
| XLogP | 3.28 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.89 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |