C36H20F3N3O — CID 134411551
8-[4-(9-phenyl-1,10-phenanthrolin-2-yl)phenyl]-3-(trifluoromethyl)-[1]benzofuro[3,2-b]pyridine (PubChem CID 134411551) has the molecular formula C36H20F3N3O and a molecular weight of 567.57 g/mol. Its IUPAC name is 8-[4-(9-phenyl-1,10-phenanthrolin-2-yl)phenyl]-3-(trifluoromethyl)-[1]benzofuro[3,2-b]pyridine.
| Compound Name | 8-[4-(9-phenyl-1,10-phenanthrolin-2-yl)phenyl]-3-(trifluoromethyl)-[1]benzofuro[3,2-b]pyridine |
|---|---|
| PubChem CID | 134411551 |
| Molecular Formula | C36H20F3N3O |
| Molecular Weight | 567.57 g/mol |
| Exact Mass | 567.16 |
| IUPAC Name | 8-[4-(9-phenyl-1,10-phenanthrolin-2-yl)phenyl]-3-(trifluoromethyl)-[1]benzofuro[3,2-b]pyridine |
| SMILES | FC(F)(F)c1cnc2c(c1)oc1ccc(-c3ccc(-c4ccc5ccc6ccc(-c7ccccc7)nc6c5n4)cc3)cc12 |
| InChI | InChI=1S/C36H20F3N3O/c37-36(38,39)27-19-32-35(40-20-27)28-18-26(14-17-31(28)43-32)21-6-8-23(9-7-21)30-16-13-25-11-10-24-12-15-29(22-4-2-1-3-5-22)41-33(24)34(25)42-30/h1-20H |
| InChIKey | IDBJCOJDRMINMC-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.57 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|