C22H22F4N2O3 — CID 134412620
(3R,4R)-4-[3-ethoxy-4-(trifluoromethyl)phenyl]-N-(3-fluoro-2-methylphenyl)-1-methyl-2-oxopyrrolidine-3-carboxamide (PubChem CID 134412620) has the molecular formula C22H22F4N2O3 and a molecular weight of 438.42 g/mol. Its IUPAC name is (3R,4R)-4-[3-ethoxy-4-(trifluoromethyl)phenyl]-N-(3-fluoro-2-methylphenyl)-1-methyl-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-4-[3-ethoxy-4-(trifluoromethyl)phenyl]-N-(3-fluoro-2-methylphenyl)-1-methyl-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134412620 |
| Molecular Formula | C22H22F4N2O3 |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | (3R,4R)-4-[3-ethoxy-4-(trifluoromethyl)phenyl]-N-(3-fluoro-2-methylphenyl)-1-methyl-2-oxopyrrolidine-3-carboxamide |
| SMILES | CCOc1cc([C@@H]2CN(C)C(=O)[C@H]2C(=O)Nc2cccc(F)c2C)ccc1C(F)(F)F |
| InChI | InChI=1S/C22H22F4N2O3/c1-4-31-18-10-13(8-9-15(18)22(24,25)26)14-11-28(3)21(30)19(14)20(29)27-17-7-5-6-16(23)12(17)2/h5-10,14,19H,4,11H2,1-3H3,(H,27,29)/t14-,19+/m0/s1 |
| InChIKey | ONNZMBXEWAZHAF-IFXJQAMLSA-N |
| XLogP | 4.36 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|