C18H15F2N2O2Tl — CID 163597452
[2-fluoro-5-[4-[(2-fluorophenyl)carbamoyl]-1-methyl-5-oxopyrrolidin-3-yl]phenyl]thallium (PubChem CID 163597452) has the molecular formula C18H15F2N2O2Tl and a molecular weight of 533.71 g/mol. Its IUPAC name is [2-fluoro-5-[4-[(2-fluorophenyl)carbamoyl]-1-methyl-5-oxopyrrolidin-3-yl]phenyl]thallium.
| Compound Name | [2-fluoro-5-[4-[(2-fluorophenyl)carbamoyl]-1-methyl-5-oxopyrrolidin-3-yl]phenyl]thallium |
|---|---|
| PubChem CID | 163597452 |
| Molecular Formula | C18H15F2N2O2Tl |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 534.08 |
| IUPAC Name | [2-fluoro-5-[4-[(2-fluorophenyl)carbamoyl]-1-methyl-5-oxopyrrolidin-3-yl]phenyl]thallium |
| SMILES | CN1CC(c2ccc(F)c([Tl])c2)C(C(=O)Nc2ccccc2F)C1=O |
| InChI | InChI=1S/C18H15F2N2O2.Tl/c1-22-10-13(11-6-8-12(19)9-7-11)16(18(22)24)17(23)21-15-5-3-2-4-14(15)20;/h2-8,13,16H,10H2,1H3,(H,21,23); |
| InChIKey | GURPPVVYJIGJAV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|