C20H18FN3O4S — CID 134412638
(3S,4S)-4-(3-cyano-4-fluorophenyl)-1-methyl-N-(2-methylsulfonylphenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 134412638) has the molecular formula C20H18FN3O4S and a molecular weight of 415.45 g/mol. Its IUPAC name is (3S,4S)-4-(3-cyano-4-fluorophenyl)-1-methyl-N-(2-methylsulfonylphenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-4-(3-cyano-4-fluorophenyl)-1-methyl-N-(2-methylsulfonylphenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134412638 |
| Molecular Formula | C20H18FN3O4S |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | (3S,4S)-4-(3-cyano-4-fluorophenyl)-1-methyl-N-(2-methylsulfonylphenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | CN1C[C@H](c2ccc(F)c(C#N)c2)[C@@H](C(=O)Nc2ccccc2S(C)(=O)=O)C1=O |
| InChI | InChI=1S/C20H18FN3O4S/c1-24-11-14(12-7-8-15(21)13(9-12)10-22)18(20(24)26)19(25)23-16-5-3-4-6-17(16)29(2,27)28/h3-9,14,18H,11H2,1-2H3,(H,23,25)/t14-,18+/m1/s1 |
| InChIKey | XXLCRPZGZUYZIK-KDOFPFPSSA-N |
| XLogP | 1.91 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|