C19H18F2N2O4S — CID 134411677
(3S,4S)-4-(3,5-difluorophenyl)-1-methyl-N-(2-methylsulfonylphenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 134411677) has the molecular formula C19H18F2N2O4S and a molecular weight of 408.43 g/mol. Its IUPAC name is (3S,4S)-4-(3,5-difluorophenyl)-1-methyl-N-(2-methylsulfonylphenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-4-(3,5-difluorophenyl)-1-methyl-N-(2-methylsulfonylphenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134411677 |
| Molecular Formula | C19H18F2N2O4S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | (3S,4S)-4-(3,5-difluorophenyl)-1-methyl-N-(2-methylsulfonylphenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | CN1C[C@H](c2cc(F)cc(F)c2)[C@@H](C(=O)Nc2ccccc2S(C)(=O)=O)C1=O |
| InChI | InChI=1S/C19H18F2N2O4S/c1-23-10-14(11-7-12(20)9-13(21)8-11)17(19(23)25)18(24)22-15-5-3-4-6-16(15)28(2,26)27/h3-9,14,17H,10H2,1-2H3,(H,22,24)/t14-,17+/m1/s1 |
| InChIKey | ASRWZDGAPUSJSP-PBHICJAKSA-N |
| XLogP | 2.18 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|