C21H22F2N2O5S — CID 134411795
(3S,4S)-4-[3-(difluoromethoxymethyl)phenyl]-1-methyl-N-(2-methylsulfonylphenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 134411795) has the molecular formula C21H22F2N2O5S and a molecular weight of 452.48 g/mol. Its IUPAC name is (3S,4S)-4-[3-(difluoromethoxymethyl)phenyl]-1-methyl-N-(2-methylsulfonylphenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-4-[3-(difluoromethoxymethyl)phenyl]-1-methyl-N-(2-methylsulfonylphenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134411795 |
| Molecular Formula | C21H22F2N2O5S |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | (3S,4S)-4-[3-(difluoromethoxymethyl)phenyl]-1-methyl-N-(2-methylsulfonylphenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | CN1C[C@H](c2cccc(COC(F)F)c2)[C@@H](C(=O)Nc2ccccc2S(C)(=O)=O)C1=O |
| InChI | InChI=1S/C21H22F2N2O5S/c1-25-11-15(14-7-5-6-13(10-14)12-30-21(22)23)18(20(25)27)19(26)24-16-8-3-4-9-17(16)31(2,28)29/h3-10,15,18,21H,11-12H2,1-2H3,(H,24,26)/t15-,18+/m1/s1 |
| InChIKey | NVKVDVYIDBKUBV-QAPCUYQASA-N |
| XLogP | 2.64 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|