C22H26N2O4S — CID 134416093
(3S,4S)-1-methyl-N-(2-methylsulfonylphenyl)-2-oxo-4-(3-propan-2-ylphenyl)pyrrolidine-3-carboxamide (PubChem CID 134416093) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is (3S,4S)-1-methyl-N-(2-methylsulfonylphenyl)-2-oxo-4-(3-propan-2-ylphenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-1-methyl-N-(2-methylsulfonylphenyl)-2-oxo-4-(3-propan-2-ylphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134416093 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | (3S,4S)-1-methyl-N-(2-methylsulfonylphenyl)-2-oxo-4-(3-propan-2-ylphenyl)pyrrolidine-3-carboxamide |
| SMILES | CC(C)c1cccc([C@H]2CN(C)C(=O)[C@@H]2C(=O)Nc2ccccc2S(C)(=O)=O)c1 |
| InChI | InChI=1S/C22H26N2O4S/c1-14(2)15-8-7-9-16(12-15)17-13-24(3)22(26)20(17)21(25)23-18-10-5-6-11-19(18)29(4,27)28/h5-12,14,17,20H,13H2,1-4H3,(H,23,25)/t17-,20+/m1/s1 |
| InChIKey | IYSQZLWRFUZOFH-XLIONFOSSA-N |
| XLogP | 3.02 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|