C22H23F2NO2 — CID 159496808
(3S,4S)-3-[2-(2,4-difluorophenyl)acetyl]-1-methyl-4-(3-propan-2-ylphenyl)pyrrolidin-2-one (PubChem CID 159496808) has the molecular formula C22H23F2NO2 and a molecular weight of 371.43 g/mol. Its IUPAC name is (3S,4S)-3-[2-(2,4-difluorophenyl)acetyl]-1-methyl-4-(3-propan-2-ylphenyl)pyrrolidin-2-one.
| Compound Name | (3S,4S)-3-[2-(2,4-difluorophenyl)acetyl]-1-methyl-4-(3-propan-2-ylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 159496808 |
| Molecular Formula | C22H23F2NO2 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (3S,4S)-3-[2-(2,4-difluorophenyl)acetyl]-1-methyl-4-(3-propan-2-ylphenyl)pyrrolidin-2-one |
| SMILES | CC(C)c1cccc([C@H]2CN(C)C(=O)[C@@H]2C(=O)Cc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C22H23F2NO2/c1-13(2)14-5-4-6-15(9-14)18-12-25(3)22(27)21(18)20(26)10-16-7-8-17(23)11-19(16)24/h4-9,11,13,18,21H,10,12H2,1-3H3/t18-,21+/m1/s1 |
| InChIKey | LYWQAPXYUKOFND-NQIIRXRSSA-N |
| XLogP | 4.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|