C20H15F3N2O2 — CID 161017805
3-[(3S,4S)-1-methyl-5-oxo-4-[2-(2,3,4-trifluorophenyl)acetyl]pyrrolidin-3-yl]benzonitrile (PubChem CID 161017805) has the molecular formula C20H15F3N2O2 and a molecular weight of 372.35 g/mol. Its IUPAC name is 3-[(3S,4S)-1-methyl-5-oxo-4-[2-(2,3,4-trifluorophenyl)acetyl]pyrrolidin-3-yl]benzonitrile.
| Compound Name | 3-[(3S,4S)-1-methyl-5-oxo-4-[2-(2,3,4-trifluorophenyl)acetyl]pyrrolidin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 161017805 |
| Molecular Formula | C20H15F3N2O2 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 3-[(3S,4S)-1-methyl-5-oxo-4-[2-(2,3,4-trifluorophenyl)acetyl]pyrrolidin-3-yl]benzonitrile |
| SMILES | CN1C[C@H](c2cccc(C#N)c2)[C@@H](C(=O)Cc2ccc(F)c(F)c2F)C1=O |
| InChI | InChI=1S/C20H15F3N2O2/c1-25-10-14(12-4-2-3-11(7-12)9-24)17(20(25)27)16(26)8-13-5-6-15(21)19(23)18(13)22/h2-7,14,17H,8,10H2,1H3/t14-,17+/m1/s1 |
| InChIKey | TXYNBKJARZJHAJ-PBHICJAKSA-N |
| XLogP | 2.96 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|