C19H17F3N2O2S — CID 134411782
(3S,4S)-1-methyl-N-(2-methylsulfanylphenyl)-2-oxo-4-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide (PubChem CID 134411782) has the molecular formula C19H17F3N2O2S and a molecular weight of 394.42 g/mol. Its IUPAC name is (3S,4S)-1-methyl-N-(2-methylsulfanylphenyl)-2-oxo-4-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-1-methyl-N-(2-methylsulfanylphenyl)-2-oxo-4-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134411782 |
| Molecular Formula | C19H17F3N2O2S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | (3S,4S)-1-methyl-N-(2-methylsulfanylphenyl)-2-oxo-4-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide |
| SMILES | CSc1ccccc1NC(=O)[C@H]1C(=O)N(C)C[C@@H]1c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C19H17F3N2O2S/c1-24-9-11(10-7-12(20)17(22)13(21)8-10)16(19(24)26)18(25)23-14-5-3-4-6-15(14)27-2/h3-8,11,16H,9H2,1-2H3,(H,23,25)/t11-,16+/m1/s1 |
| InChIKey | IVFCDQWDBAGUIJ-BZNIZROVSA-N |
| XLogP | 3.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|