C34H42FN5O6 — CID 134414323
tert-butyl 4-[4-[[1-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-hydroxy-3-oxo-1H-isoindol-5-yl]piperidin-4-yl]methyl]piperazin-1-yl]benzoate (PubChem CID 134414323) has the molecular formula C34H42FN5O6 and a molecular weight of 635.74 g/mol. Its IUPAC name is tert-butyl 4-[4-[[1-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-hydroxy-3-oxo-1H-isoindol-5-yl]piperidin-4-yl]methyl]piperazin-1-yl]benzoate.
| Compound Name | tert-butyl 4-[4-[[1-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-hydroxy-3-oxo-1H-isoindol-5-yl]piperidin-4-yl]methyl]piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 134414323 |
| Molecular Formula | C34H42FN5O6 |
| Molecular Weight | 635.74 g/mol |
| Exact Mass | 635.31 |
| IUPAC Name | tert-butyl 4-[4-[[1-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-hydroxy-3-oxo-1H-isoindol-5-yl]piperidin-4-yl]methyl]piperazin-1-yl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(N2CCN(CC3CCN(c4cc5c(cc4F)C(O)N(C4CCC(=O)NC4=O)C5=O)CC3)CC2)cc1 |
| InChI | InChI=1S/C34H42FN5O6/c1-34(2,3)46-33(45)22-4-6-23(7-5-22)38-16-14-37(15-17-38)20-21-10-12-39(13-11-21)28-19-25-24(18-26(28)35)31(43)40(32(25)44)27-8-9-29(41)36-30(27)42/h4-7,18-19,21,27,31,43H,8-17,20H2,1-3H3,(H,36,41,42) |
| InChIKey | VQBWDNUMHNVVHS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.74 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|