C24H21IN2O2S — CID 134414612
3-[2-(4-iodo-2,6-dimethylphenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-6-yl]benzonitrile (PubChem CID 134414612) has the molecular formula C24H21IN2O2S and a molecular weight of 528.42 g/mol. Its IUPAC name is 3-[2-(4-iodo-2,6-dimethylphenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-6-yl]benzonitrile.
| Compound Name | 3-[2-(4-iodo-2,6-dimethylphenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 134414612 |
| Molecular Formula | C24H21IN2O2S |
| Molecular Weight | 528.42 g/mol |
| Exact Mass | 528.04 |
| IUPAC Name | 3-[2-(4-iodo-2,6-dimethylphenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-6-yl]benzonitrile |
| SMILES | Cc1cc(I)cc(C)c1S(=O)(=O)N1CCc2cc(-c3cccc(C#N)c3)ccc2C1 |
| InChI | InChI=1S/C24H21IN2O2S/c1-16-10-23(25)11-17(2)24(16)30(28,29)27-9-8-21-13-20(6-7-22(21)15-27)19-5-3-4-18(12-19)14-26/h3-7,10-13H,8-9,15H2,1-2H3 |
| InChIKey | WBZRMOSWFCTIGW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|