C9H9Cl2NO2S — CID 134419068
2,6-dichloro-4-methoxy-N-methylsulfanylbenzamide (PubChem CID 134419068) has the molecular formula C9H9Cl2NO2S and a molecular weight of 266.15 g/mol. Its IUPAC name is 2,6-dichloro-4-methoxy-N-methylsulfanylbenzamide.
| Compound Name | 2,6-dichloro-4-methoxy-N-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 134419068 |
| Molecular Formula | C9H9Cl2NO2S |
| Molecular Weight | 266.15 g/mol |
| Exact Mass | 264.97 |
| IUPAC Name | 2,6-dichloro-4-methoxy-N-methylsulfanylbenzamide |
| SMILES | COc1cc(Cl)c(C(=O)NSC)c(Cl)c1 |
| InChI | InChI=1S/C9H9Cl2NO2S/c1-14-5-3-6(10)8(7(11)4-5)9(13)12-15-2/h3-4H,1-2H3,(H,12,13) |
| InChIKey | OFBMSKSBDOIXGD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.15 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|