C74H72N2 — CID 134419128
N,N-diphenyl-4-[7-[7-[4-(N-phenylanilino)cyclohexa-1,5-dien-1-yl]-9,9-dipropyl-7,8-dihydrofluoren-2-yl]-9,9-dipropylfluoren-2-yl]aniline (PubChem CID 134419128) has the molecular formula C74H72N2 and a molecular weight of 989.40 g/mol. Its IUPAC name is N,N-diphenyl-4-[7-[7-[4-(N-phenylanilino)cyclohexa-1,5-dien-1-yl]-9,9-dipropyl-7,8-dihydrofluoren-2-yl]-9,9-dipropylfluoren-2-yl]aniline.
| Compound Name | N,N-diphenyl-4-[7-[7-[4-(N-phenylanilino)cyclohexa-1,5-dien-1-yl]-9,9-dipropyl-7,8-dihydrofluoren-2-yl]-9,9-dipropylfluoren-2-yl]aniline |
|---|---|
| PubChem CID | 134419128 |
| Molecular Formula | C74H72N2 |
| Molecular Weight | 989.40 g/mol |
| Exact Mass | 988.57 |
| IUPAC Name | N,N-diphenyl-4-[7-[7-[4-(N-phenylanilino)cyclohexa-1,5-dien-1-yl]-9,9-dipropyl-7,8-dihydrofluoren-2-yl]-9,9-dipropylfluoren-2-yl]aniline |
| SMILES | CCCC1(CCC)C2=C(C=CC(C3=CCC(N(c4ccccc4)c4ccccc4)C=C3)C2)c2ccc(-c3ccc4c(c3)C(CCC)(CCC)c3cc(-c5ccc(N(c6ccccc6)c6ccccc6)cc5)ccc3-4)cc21 |
| InChI | InChI=1S/C74H72N2/c1-5-45-73(46-6-2)69-49-55(53-29-37-63(38-30-53)75(59-21-13-9-14-22-59)60-23-15-10-16-24-60)33-41-65(69)67-43-35-57(51-71(67)73)58-36-44-68-66-42-34-56(50-70(66)74(47-7-3,48-8-4)72(68)52-58)54-31-39-64(40-32-54)76(61-25-17-11-18-26-61)62-27-19-12-20-28-62/h9-39,41-44,49,51-52,56,64H,5-8,40,45-48,50H2,1-4H3 |
| InChIKey | WXHZBLYRUCUKPM-UHFFFAOYSA-N |
| XLogP | 20.63 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 989.40 |
| LogP ≤ 5 | 20.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |