C42H36N4 — CID 143113021
4-N-[4-[4-[4-(N-(4-aminocyclohexa-2,4-dien-1-yl)anilino)phenyl]phenyl]phenyl]-4-N-phenylbenzene-1,4-diamine (PubChem CID 143113021) has the molecular formula C42H36N4 and a molecular weight of 596.78 g/mol. Its IUPAC name is 4-N-[4-[4-[4-(N-(4-aminocyclohexa-2,4-dien-1-yl)anilino)phenyl]phenyl]phenyl]-4-N-phenylbenzene-1,4-diamine.
| Compound Name | 4-N-[4-[4-[4-(N-(4-aminocyclohexa-2,4-dien-1-yl)anilino)phenyl]phenyl]phenyl]-4-N-phenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 143113021 |
| Molecular Formula | C42H36N4 |
| Molecular Weight | 596.78 g/mol |
| Exact Mass | 596.29 |
| IUPAC Name | 4-N-[4-[4-[4-(N-(4-aminocyclohexa-2,4-dien-1-yl)anilino)phenyl]phenyl]phenyl]-4-N-phenylbenzene-1,4-diamine |
| SMILES | NC1=CCC(N(c2ccccc2)c2ccc(-c3ccc(-c4ccc(N(c5ccccc5)c5ccc(N)cc5)cc4)cc3)cc2)C=C1 |
| InChI | InChI=1S/C42H36N4/c43-35-19-27-41(28-20-35)45(37-7-3-1-4-8-37)39-23-15-33(16-24-39)31-11-13-32(14-12-31)34-17-25-40(26-18-34)46(38-9-5-2-6-10-38)42-29-21-36(44)22-30-42/h1-29,42H,30,43-44H2 |
| InChIKey | NCQKGVWNOBURQH-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.78 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|