C18H16BrN — CID 144816017
N-[(1S)-4-bromocyclohexa-2,4-dien-1-yl]-N-phenylaniline (PubChem CID 144816017) has the molecular formula C18H16BrN and a molecular weight of 326.24 g/mol. Its IUPAC name is N-[(1S)-4-bromocyclohexa-2,4-dien-1-yl]-N-phenylaniline.
| Compound Name | N-[(1S)-4-bromocyclohexa-2,4-dien-1-yl]-N-phenylaniline |
|---|---|
| PubChem CID | 144816017 |
| Molecular Formula | C18H16BrN |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | N-[(1S)-4-bromocyclohexa-2,4-dien-1-yl]-N-phenylaniline |
| SMILES | BrC1=CC[C@H](N(c2ccccc2)c2ccccc2)C=C1 |
| InChI | InChI=1S/C18H16BrN/c19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-13,18H,14H2/t18-/m1/s1 |
| InChIKey | IMASEVQEMBTYHU-GOSISDBHSA-N |
| XLogP | 5.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |