C24H20BNO2S — CID 144888469
[4-(N-dibenzothiophen-2-ylanilino)cyclohexa-1,5-dien-1-yl]boronic acid (PubChem CID 144888469) has the molecular formula C24H20BNO2S and a molecular weight of 397.31 g/mol. Its IUPAC name is [4-(N-dibenzothiophen-2-ylanilino)cyclohexa-1,5-dien-1-yl]boronic acid.
| Compound Name | [4-(N-dibenzothiophen-2-ylanilino)cyclohexa-1,5-dien-1-yl]boronic acid |
|---|---|
| PubChem CID | 144888469 |
| Molecular Formula | C24H20BNO2S |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | [4-(N-dibenzothiophen-2-ylanilino)cyclohexa-1,5-dien-1-yl]boronic acid |
| SMILES | OB(O)C1=CCC(N(c2ccccc2)c2ccc3sc4ccccc4c3c2)C=C1 |
| InChI | InChI=1S/C24H20BNO2S/c27-25(28)17-10-12-19(13-11-17)26(18-6-2-1-3-7-18)20-14-15-24-22(16-20)21-8-4-5-9-23(21)29-24/h1-12,14-16,19,27-28H,13H2 |
| InChIKey | NRZNDCRMPGFUHI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|