C25H26BNO2 — CID 143813870
[4-(N-(4-methylcyclohexa-1,5-dien-1-yl)-4-phenylanilino)cyclohexa-1,5-dien-1-yl]boronic acid (PubChem CID 143813870) has the molecular formula C25H26BNO2 and a molecular weight of 383.30 g/mol. Its IUPAC name is [4-(N-(4-methylcyclohexa-1,5-dien-1-yl)-4-phenylanilino)cyclohexa-1,5-dien-1-yl]boronic acid.
| Compound Name | [4-(N-(4-methylcyclohexa-1,5-dien-1-yl)-4-phenylanilino)cyclohexa-1,5-dien-1-yl]boronic acid |
|---|---|
| PubChem CID | 143813870 |
| Molecular Formula | C25H26BNO2 |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | [4-(N-(4-methylcyclohexa-1,5-dien-1-yl)-4-phenylanilino)cyclohexa-1,5-dien-1-yl]boronic acid |
| SMILES | CC1C=CC(N(c2ccc(-c3ccccc3)cc2)C2C=CC(B(O)O)=CC2)=CC1 |
| InChI | InChI=1S/C25H26BNO2/c1-19-7-13-23(14-8-19)27(25-17-11-22(12-18-25)26(28)29)24-15-9-21(10-16-24)20-5-3-2-4-6-20/h2-7,9-17,19,25,28-29H,8,18H2,1H3 |
| InChIKey | PAZVEIWUKPEEHG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|