C38H33N — CID 89189838
N-cyclohexa-1,5-dien-1-yl-N-cyclohexa-2,4-dien-1-yl-4-[(E)-2-[4-(4-phenylphenyl)phenyl]ethenyl]aniline (PubChem CID 89189838) has the molecular formula C38H33N and a molecular weight of 503.69 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-N-cyclohexa-2,4-dien-1-yl-4-[(E)-2-[4-(4-phenylphenyl)phenyl]ethenyl]aniline.
| Compound Name | N-cyclohexa-1,5-dien-1-yl-N-cyclohexa-2,4-dien-1-yl-4-[(E)-2-[4-(4-phenylphenyl)phenyl]ethenyl]aniline |
|---|---|
| PubChem CID | 89189838 |
| Molecular Formula | C38H33N |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-N-cyclohexa-2,4-dien-1-yl-4-[(E)-2-[4-(4-phenylphenyl)phenyl]ethenyl]aniline |
| SMILES | C1=CCC(N(C2=CCCC=C2)c2ccc(/C=C/c3ccc(-c4ccc(-c5ccccc5)cc4)cc3)cc2)C=C1 |
| InChI | InChI=1S/C38H33N/c1-4-10-32(11-5-1)34-24-26-35(27-25-34)33-22-18-30(19-23-33)16-17-31-20-28-38(29-21-31)39(36-12-6-2-7-13-36)37-14-8-3-9-15-37/h1-2,4-8,10-12,14-29,36H,3,9,13H2/b17-16+ |
| InChIKey | UXXBJMALBCVNDI-WUKNDPDISA-N |
| XLogP | 10.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|