C58H55N2O3PS — CID 143308518
N-cyclohexa-2,4-dien-1-yl-4-[5-[4-(N-cyclohexa-1,5-dien-1-ylanilino)phenyl]-4-diphenoxyphosphorylthiophen-2-yl]-N-phenylaniline;bis(prop-1-ene) (PubChem CID 143308518) has the molecular formula C58H55N2O3PS and a molecular weight of 891.13 g/mol. Its IUPAC name is N-cyclohexa-2,4-dien-1-yl-4-[5-[4-(N-cyclohexa-1,5-dien-1-ylanilino)phenyl]-4-diphenoxyphosphorylthiophen-2-yl]-N-phenylaniline;bis(prop-1-ene).
| Compound Name | N-cyclohexa-2,4-dien-1-yl-4-[5-[4-(N-cyclohexa-1,5-dien-1-ylanilino)phenyl]-4-diphenoxyphosphorylthiophen-2-yl]-N-phenylaniline;bis(prop-1-ene) |
|---|---|
| PubChem CID | 143308518 |
| Molecular Formula | C58H55N2O3PS |
| Molecular Weight | 891.13 g/mol |
| Exact Mass | 890.37 |
| IUPAC Name | N-cyclohexa-2,4-dien-1-yl-4-[5-[4-(N-cyclohexa-1,5-dien-1-ylanilino)phenyl]-4-diphenoxyphosphorylthiophen-2-yl]-N-phenylaniline;bis(prop-1-ene) |
| SMILES | C=CC.C=CC.O=P(Oc1ccccc1)(Oc1ccccc1)c1cc(-c2ccc(N(c3ccccc3)C3C=CC=CC3)cc2)sc1-c1ccc(N(C2=CCCC=C2)c2ccccc2)cc1 |
| InChI | InChI=1S/C52H43N2O3PS.2C3H6/c55-58(56-48-27-15-5-16-28-48,57-49-29-17-6-18-30-49)50-39-51(40-31-35-46(36-32-40)53(42-19-7-1-8-20-42)43-21-9-2-10-22-43)59-52(50)41-33-37-47(38-34-41)54(44-23-11-3-12-24-44)45-25-13-4-14-26-45;2*1-3-2/h1-3,5-13,15-21,23-39,43H,4,14,22H2;2*3H,1H2,2H3 |
| InChIKey | PSVPCNSTVKKTAO-UHFFFAOYSA-N |
| XLogP | 16.84 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.13 |
| LogP ≤ 5 | 16.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|