C52H39N2O3PS — CID 59155891
4-[4-diphenoxyphosphoryl-5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-N,N-diphenylaniline (PubChem CID 59155891) has the molecular formula C52H39N2O3PS and a molecular weight of 802.94 g/mol. Its IUPAC name is 4-[4-diphenoxyphosphoryl-5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-N,N-diphenylaniline.
| Compound Name | 4-[4-diphenoxyphosphoryl-5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 59155891 |
| Molecular Formula | C52H39N2O3PS |
| Molecular Weight | 802.94 g/mol |
| Exact Mass | 802.24 |
| IUPAC Name | 4-[4-diphenoxyphosphoryl-5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-N,N-diphenylaniline |
| SMILES | O=P(Oc1ccccc1)(Oc1ccccc1)c1cc(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)sc1-c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C52H39N2O3PS/c55-58(56-48-27-15-5-16-28-48,57-49-29-17-6-18-30-49)50-39-51(40-31-35-46(36-32-40)53(42-19-7-1-8-20-42)43-21-9-2-10-22-43)59-52(50)41-33-37-47(38-34-41)54(44-23-11-3-12-24-44)45-25-13-4-14-26-45/h1-39H |
| InChIKey | JEXDLTWCTAEORO-UHFFFAOYSA-N |
| XLogP | 15.00 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.94 |
| LogP ≤ 5 | 15.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|