C49H33F3N2O2S2 — CID 163660304
methyl 2-[4,10-bis[4-(N-phenylanilino)phenyl]-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-ylidene]-3,3,3-trifluoropropanoate (PubChem CID 163660304) has the molecular formula C49H33F3N2O2S2 and a molecular weight of 802.94 g/mol. Its IUPAC name is methyl 2-[4,10-bis[4-(N-phenylanilino)phenyl]-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-ylidene]-3,3,3-trifluoropropanoate.
| Compound Name | methyl 2-[4,10-bis[4-(N-phenylanilino)phenyl]-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-ylidene]-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 163660304 |
| Molecular Formula | C49H33F3N2O2S2 |
| Molecular Weight | 802.94 g/mol |
| Exact Mass | 802.19 |
| IUPAC Name | methyl 2-[4,10-bis[4-(N-phenylanilino)phenyl]-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-ylidene]-3,3,3-trifluoropropanoate |
| SMILES | COC(=O)C(=C1c2cc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)sc2-c2sc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc21)C(F)(F)F |
| InChI | InChI=1S/C49H33F3N2O2S2/c1-56-48(55)45(49(50,51)52)44-40-30-42(32-22-26-38(27-23-32)53(34-14-6-2-7-15-34)35-16-8-3-9-17-35)57-46(40)47-41(44)31-43(58-47)33-24-28-39(29-25-33)54(36-18-10-4-11-19-36)37-20-12-5-13-21-37/h2-31H,1H3 |
| InChIKey | ITUXFBJSOWAIOV-UHFFFAOYSA-N |
| XLogP | 14.60 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.94 |
| LogP ≤ 5 | 14.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|