C30H30BNO2S — CID 174085540
N-cyclohexa-2,4-dien-1-yl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]dibenzothiophen-2-amine (PubChem CID 174085540) has the molecular formula C30H30BNO2S and a molecular weight of 479.45 g/mol. Its IUPAC name is N-cyclohexa-2,4-dien-1-yl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]dibenzothiophen-2-amine.
| Compound Name | N-cyclohexa-2,4-dien-1-yl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]dibenzothiophen-2-amine |
|---|---|
| PubChem CID | 174085540 |
| Molecular Formula | C30H30BNO2S |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | N-cyclohexa-2,4-dien-1-yl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]dibenzothiophen-2-amine |
| SMILES | CC1(C)OB(c2ccc(N(c3ccc4sc5ccccc5c4c3)C3C=CC=CC3)cc2)OC1(C)C |
| InChI | InChI=1S/C30H30BNO2S/c1-29(2)30(3,4)34-31(33-29)21-14-16-23(17-15-21)32(22-10-6-5-7-11-22)24-18-19-28-26(20-24)25-12-8-9-13-27(25)35-28/h5-10,12-20,22H,11H2,1-4H3 |
| InChIKey | CSMRFDVPBDSWHG-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|