C17H32NO2+ — CID 134419209
[(2R)-3,3-dimethylbutan-2-yl] 4-(1-azoniabicyclo[2.2.2]octan-1-yl)butanoate (PubChem CID 134419209) has the molecular formula C17H32NO2+ and a molecular weight of 282.45 g/mol. Its IUPAC name is [(2R)-3,3-dimethylbutan-2-yl] 4-(1-azoniabicyclo[2.2.2]octan-1-yl)butanoate.
| Compound Name | [(2R)-3,3-dimethylbutan-2-yl] 4-(1-azoniabicyclo[2.2.2]octan-1-yl)butanoate |
|---|---|
| PubChem CID | 134419209 |
| Molecular Formula | C17H32NO2+ |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | [(2R)-3,3-dimethylbutan-2-yl] 4-(1-azoniabicyclo[2.2.2]octan-1-yl)butanoate |
| SMILES | C[C@@H](OC(=O)CCC[N+]12CCC(CC1)CC2)C(C)(C)C |
| InChI | InChI=1S/C17H32NO2/c1-14(17(2,3)4)20-16(19)6-5-10-18-11-7-15(8-12-18)9-13-18/h14-15H,5-13H2,1-4H3/q+1/t14-,15?,18?/m1/s1 |
| InChIKey | LPQSTFQLJUFFJQ-KSTDHSDQSA-N |
| XLogP | 3.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|