C18H23NOS — CID 134420039
(1R,2R)-3-(methylamino)-2-naphthalen-2-yl-1-(thiolan-2-yl)propan-1-ol (PubChem CID 134420039) has the molecular formula C18H23NOS and a molecular weight of 301.45 g/mol. Its IUPAC name is (1R,2R)-3-(methylamino)-2-naphthalen-2-yl-1-(thiolan-2-yl)propan-1-ol.
| Compound Name | (1R,2R)-3-(methylamino)-2-naphthalen-2-yl-1-(thiolan-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 134420039 |
| Molecular Formula | C18H23NOS |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | (1R,2R)-3-(methylamino)-2-naphthalen-2-yl-1-(thiolan-2-yl)propan-1-ol |
| SMILES | CNC[C@@H](c1ccc2ccccc2c1)[C@@H](O)C1CCCS1 |
| InChI | InChI=1S/C18H23NOS/c1-19-12-16(18(20)17-7-4-10-21-17)15-9-8-13-5-2-3-6-14(13)11-15/h2-3,5-6,8-9,11,16-20H,4,7,10,12H2,1H3/t16-,17?,18+/m0/s1 |
| InChIKey | XTPLKMGSVYQZDV-PXKIYYGHSA-N |
| XLogP | 3.40 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |