C22H42N2O2 — CID 134421876
2,2-dimethyl-N-[(3R)-3-methyl-1-[methyl-[(3S)-3-methylheptan-4-yl]amino]-1-oxopentan-2-yl]pent-4-enamide (PubChem CID 134421876) has the molecular formula C22H42N2O2 and a molecular weight of 366.59 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(3R)-3-methyl-1-[methyl-[(3S)-3-methylheptan-4-yl]amino]-1-oxopentan-2-yl]pent-4-enamide.
| Compound Name | 2,2-dimethyl-N-[(3R)-3-methyl-1-[methyl-[(3S)-3-methylheptan-4-yl]amino]-1-oxopentan-2-yl]pent-4-enamide |
|---|---|
| PubChem CID | 134421876 |
| Molecular Formula | C22H42N2O2 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.32 |
| IUPAC Name | 2,2-dimethyl-N-[(3R)-3-methyl-1-[methyl-[(3S)-3-methylheptan-4-yl]amino]-1-oxopentan-2-yl]pent-4-enamide |
| SMILES | C=CCC(C)(C)C(=O)NC(C(=O)N(C)C(CCC)[C@@H](C)CC)[C@H](C)CC |
| InChI | InChI=1S/C22H42N2O2/c1-10-14-18(16(5)12-3)24(9)20(25)19(17(6)13-4)23-21(26)22(7,8)15-11-2/h11,16-19H,2,10,12-15H2,1,3-9H3,(H,23,26)/t16-,17+,18?,19?/m0/s1 |
| InChIKey | DDMSUYUYEBTDEY-FKAKGIQBSA-N |
| XLogP | 4.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|