C14H13ClF2N4O2 — CID 134422963
N-[6-chloro-2-[2-(3,3-difluoropyrrolidin-1-yl)-2-oxoethyl]indazol-5-yl]formamide (PubChem CID 134422963) has the molecular formula C14H13ClF2N4O2 and a molecular weight of 342.73 g/mol. Its IUPAC name is N-[6-chloro-2-[2-(3,3-difluoropyrrolidin-1-yl)-2-oxoethyl]indazol-5-yl]formamide.
| Compound Name | N-[6-chloro-2-[2-(3,3-difluoropyrrolidin-1-yl)-2-oxoethyl]indazol-5-yl]formamide |
|---|---|
| PubChem CID | 134422963 |
| Molecular Formula | C14H13ClF2N4O2 |
| Molecular Weight | 342.73 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | N-[6-chloro-2-[2-(3,3-difluoropyrrolidin-1-yl)-2-oxoethyl]indazol-5-yl]formamide |
| SMILES | O=CNc1cc2cn(CC(=O)N3CCC(F)(F)C3)nc2cc1Cl |
| InChI | InChI=1S/C14H13ClF2N4O2/c15-10-4-11-9(3-12(10)18-8-22)5-21(19-11)6-13(23)20-2-1-14(16,17)7-20/h3-5,8H,1-2,6-7H2,(H,18,22) |
| InChIKey | ZPLDCNSOYRKJMF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.73 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|