C23H34N4O3 — CID 134424154
N-[(E)-3-[(E)-1-aminoethylideneamino]oxy-2-methylhept-3-en-2-yl]-5-cyclopropyl-6-(cyclopropylmethoxy)pyridine-2-carboxamide (PubChem CID 134424154) has the molecular formula C23H34N4O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is N-[(E)-3-[(E)-1-aminoethylideneamino]oxy-2-methylhept-3-en-2-yl]-5-cyclopropyl-6-(cyclopropylmethoxy)pyridine-2-carboxamide.
| Compound Name | N-[(E)-3-[(E)-1-aminoethylideneamino]oxy-2-methylhept-3-en-2-yl]-5-cyclopropyl-6-(cyclopropylmethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 134424154 |
| Molecular Formula | C23H34N4O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | N-[(E)-3-[(E)-1-aminoethylideneamino]oxy-2-methylhept-3-en-2-yl]-5-cyclopropyl-6-(cyclopropylmethoxy)pyridine-2-carboxamide |
| SMILES | CCC/C=C(/O/N=C(\C)N)C(C)(C)NC(=O)c1ccc(C2CC2)c(OCC2CC2)n1 |
| InChI | InChI=1S/C23H34N4O3/c1-5-6-7-20(30-27-15(2)24)23(3,4)26-21(28)19-13-12-18(17-10-11-17)22(25-19)29-14-16-8-9-16/h7,12-13,16-17H,5-6,8-11,14H2,1-4H3,(H2,24,27)(H,26,28)/b20-7+ |
| InChIKey | IYMVJMGFEHVKCH-IFRROFPPSA-N |
| XLogP | 4.25 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|