C22H33N3O4 — CID 71093563
5-cyclopropyl-6-(cyclopropylmethoxy)-N-[3-(2-methoxyethylcarbamoyl)pentan-3-yl]pyridine-2-carboxamide (PubChem CID 71093563) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is 5-cyclopropyl-6-(cyclopropylmethoxy)-N-[3-(2-methoxyethylcarbamoyl)pentan-3-yl]pyridine-2-carboxamide.
| Compound Name | 5-cyclopropyl-6-(cyclopropylmethoxy)-N-[3-(2-methoxyethylcarbamoyl)pentan-3-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 71093563 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 5-cyclopropyl-6-(cyclopropylmethoxy)-N-[3-(2-methoxyethylcarbamoyl)pentan-3-yl]pyridine-2-carboxamide |
| SMILES | CCC(CC)(NC(=O)c1ccc(C2CC2)c(OCC2CC2)n1)C(=O)NCCOC |
| InChI | InChI=1S/C22H33N3O4/c1-4-22(5-2,21(27)23-12-13-28-3)25-19(26)18-11-10-17(16-8-9-16)20(24-18)29-14-15-6-7-15/h10-11,15-16H,4-9,12-14H2,1-3H3,(H,23,27)(H,25,26) |
| InChIKey | DSJZBTQJBGKLNQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|