C13H24F2N2 — CID 134429460
(1R,3S,4S,6S)-3-N-tert-butyl-7,7-difluoro-4-N,4-N-dimethylbicyclo[4.1.0]heptane-3,4-diamine (PubChem CID 134429460) has the molecular formula C13H24F2N2 and a molecular weight of 246.34 g/mol. Its IUPAC name is (1R,3S,4S,6S)-3-N-tert-butyl-7,7-difluoro-4-N,4-N-dimethylbicyclo[4.1.0]heptane-3,4-diamine.
| Compound Name | (1R,3S,4S,6S)-3-N-tert-butyl-7,7-difluoro-4-N,4-N-dimethylbicyclo[4.1.0]heptane-3,4-diamine |
|---|---|
| PubChem CID | 134429460 |
| Molecular Formula | C13H24F2N2 |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | (1R,3S,4S,6S)-3-N-tert-butyl-7,7-difluoro-4-N,4-N-dimethylbicyclo[4.1.0]heptane-3,4-diamine |
| SMILES | CN(C)[C@H]1C[C@H]2[C@@H](C[C@@H]1NC(C)(C)C)C2(F)F |
| InChI | InChI=1S/C13H24F2N2/c1-12(2,3)16-10-6-8-9(13(8,14)15)7-11(10)17(4)5/h8-11,16H,6-7H2,1-5H3/t8-,9+,10+,11+/m1/s1 |
| InChIKey | ONNJARQVTHSVCN-RCWTZXSCSA-N |
| XLogP | 2.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |