C21H25ClF2N4O2S — CID 134429599
5-chloro-2-fluoro-N-(6-fluoro-2-pyridinyl)-4-[[(1S,2S)-2-pyrrolidin-1-ylcyclohexyl]amino]benzenesulfonamide (PubChem CID 134429599) has the molecular formula C21H25ClF2N4O2S and a molecular weight of 470.97 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N-(6-fluoro-2-pyridinyl)-4-[[(1S,2S)-2-pyrrolidin-1-ylcyclohexyl]amino]benzenesulfonamide.
| Compound Name | 5-chloro-2-fluoro-N-(6-fluoro-2-pyridinyl)-4-[[(1S,2S)-2-pyrrolidin-1-ylcyclohexyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 134429599 |
| Molecular Formula | C21H25ClF2N4O2S |
| Molecular Weight | 470.97 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 5-chloro-2-fluoro-N-(6-fluoro-2-pyridinyl)-4-[[(1S,2S)-2-pyrrolidin-1-ylcyclohexyl]amino]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(F)n1)c1cc(Cl)c(N[C@H]2CCCC[C@@H]2N2CCCC2)cc1F |
| InChI | InChI=1S/C21H25ClF2N4O2S/c22-14-12-19(31(29,30)27-21-9-5-8-20(24)26-21)15(23)13-17(14)25-16-6-1-2-7-18(16)28-10-3-4-11-28/h5,8-9,12-13,16,18,25H,1-4,6-7,10-11H2,(H,26,27)/t16-,18-/m0/s1 |
| InChIKey | CNJWKIPJIARDRJ-WMZOPIPTSA-N |
| XLogP | 4.63 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.97 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|