C17H21N2O3PS — CID 134431457
[3-[(6-methyl-1,3-benzothiazol-4-yl)oxy]azetidin-1-yl]-(oxan-3-ylphosphanyl)methanone (PubChem CID 134431457) has the molecular formula C17H21N2O3PS and a molecular weight of 364.41 g/mol. Its IUPAC name is [3-[(6-methyl-1,3-benzothiazol-4-yl)oxy]azetidin-1-yl]-(oxan-3-ylphosphanyl)methanone.
| Compound Name | [3-[(6-methyl-1,3-benzothiazol-4-yl)oxy]azetidin-1-yl]-(oxan-3-ylphosphanyl)methanone |
|---|---|
| PubChem CID | 134431457 |
| Molecular Formula | C17H21N2O3PS |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | [3-[(6-methyl-1,3-benzothiazol-4-yl)oxy]azetidin-1-yl]-(oxan-3-ylphosphanyl)methanone |
| SMILES | Cc1cc(OC2CN(C(=O)PC3CCCOC3)C2)c2ncsc2c1 |
| InChI | InChI=1S/C17H21N2O3PS/c1-11-5-14(16-15(6-11)24-10-18-16)22-12-7-19(8-12)17(20)23-13-3-2-4-21-9-13/h5-6,10,12-13,23H,2-4,7-9H2,1H3 |
| InChIKey | APRZLTGIKSVURJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|