C14H21FN2O — CID 134433301
1-N-ethoxy-3-N-[(4-fluorophenyl)methyl]-2-methylbut-3-ene-1,3-diamine (PubChem CID 134433301) has the molecular formula C14H21FN2O and a molecular weight of 252.33 g/mol. Its IUPAC name is 1-N-ethoxy-3-N-[(4-fluorophenyl)methyl]-2-methylbut-3-ene-1,3-diamine.
| Compound Name | 1-N-ethoxy-3-N-[(4-fluorophenyl)methyl]-2-methylbut-3-ene-1,3-diamine |
|---|---|
| PubChem CID | 134433301 |
| Molecular Formula | C14H21FN2O |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 1-N-ethoxy-3-N-[(4-fluorophenyl)methyl]-2-methylbut-3-ene-1,3-diamine |
| SMILES | C=C(NCc1ccc(F)cc1)C(C)CNOCC |
| InChI | InChI=1S/C14H21FN2O/c1-4-18-17-9-11(2)12(3)16-10-13-5-7-14(15)8-6-13/h5-8,11,16-17H,3-4,9-10H2,1-2H3 |
| InChIKey | KSJAVARWLNMUPC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|