C17H28N4O — CID 134435543
5-(methylamino)-N-[4-(pyridin-2-ylmethyl)piperidin-4-yl]pentanamide (PubChem CID 134435543) has the molecular formula C17H28N4O and a molecular weight of 304.44 g/mol. Its IUPAC name is 5-(methylamino)-N-[4-(pyridin-2-ylmethyl)piperidin-4-yl]pentanamide.
| Compound Name | 5-(methylamino)-N-[4-(pyridin-2-ylmethyl)piperidin-4-yl]pentanamide |
|---|---|
| PubChem CID | 134435543 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | 5-(methylamino)-N-[4-(pyridin-2-ylmethyl)piperidin-4-yl]pentanamide |
| SMILES | CNCCCCC(=O)NC1(Cc2ccccn2)CCNCC1 |
| InChI | InChI=1S/C17H28N4O/c1-18-10-4-3-7-16(22)21-17(8-12-19-13-9-17)14-15-6-2-5-11-20-15/h2,5-6,11,18-19H,3-4,7-10,12-14H2,1H3,(H,21,22) |
| InChIKey | ABUGQMJIILOSHL-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|