C14H12ClFN4O2 — CID 134438512
6-chloro-4-(3-fluoro-2-methoxyanilino)-2-methyl-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 134438512) has the molecular formula C14H12ClFN4O2 and a molecular weight of 322.73 g/mol. Its IUPAC name is 6-chloro-4-(3-fluoro-2-methoxyanilino)-2-methyl-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 6-chloro-4-(3-fluoro-2-methoxyanilino)-2-methyl-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 134438512 |
| Molecular Formula | C14H12ClFN4O2 |
| Molecular Weight | 322.73 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 6-chloro-4-(3-fluoro-2-methoxyanilino)-2-methyl-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | COc1c(F)cccc1Nc1cc(Cl)nc2[nH]n(C)c(=O)c12 |
| InChI | InChI=1S/C14H12ClFN4O2/c1-20-14(21)11-9(6-10(15)18-13(11)19-20)17-8-5-3-4-7(16)12(8)22-2/h3-6H,1-2H3,(H2,17,18,19) |
| InChIKey | FTGGBMHLJVPJQV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.73 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|