C20H19FN6O2 — CID 134438524
4-(3-fluoro-2-methoxyanilino)-2-methyl-6-[(4-methyl-2-pyridinyl)amino]-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 134438524) has the molecular formula C20H19FN6O2 and a molecular weight of 394.41 g/mol. Its IUPAC name is 4-(3-fluoro-2-methoxyanilino)-2-methyl-6-[(4-methyl-2-pyridinyl)amino]-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 4-(3-fluoro-2-methoxyanilino)-2-methyl-6-[(4-methyl-2-pyridinyl)amino]-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 134438524 |
| Molecular Formula | C20H19FN6O2 |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 4-(3-fluoro-2-methoxyanilino)-2-methyl-6-[(4-methyl-2-pyridinyl)amino]-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | COc1c(F)cccc1Nc1cc(Nc2cc(C)ccn2)nc2[nH]n(C)c(=O)c12 |
| InChI | InChI=1S/C20H19FN6O2/c1-11-7-8-22-15(9-11)24-16-10-14(17-19(25-16)26-27(2)20(17)28)23-13-6-4-5-12(21)18(13)29-3/h4-10H,1-3H3,(H3,22,23,24,25,26) |
| InChIKey | VPZYFSVCRNZPMG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|