C22H32N4O3 — CID 134439202
prop-2-ynyl 4-[4-(5-methoxy-2-pyridinyl)-4-(methylamino)cyclohexyl]-1,4-diazepane-1-carboxylate (PubChem CID 134439202) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is prop-2-ynyl 4-[4-(5-methoxy-2-pyridinyl)-4-(methylamino)cyclohexyl]-1,4-diazepane-1-carboxylate.
| Compound Name | prop-2-ynyl 4-[4-(5-methoxy-2-pyridinyl)-4-(methylamino)cyclohexyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 134439202 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | prop-2-ynyl 4-[4-(5-methoxy-2-pyridinyl)-4-(methylamino)cyclohexyl]-1,4-diazepane-1-carboxylate |
| SMILES | C#CCOC(=O)N1CCCN(C2CCC(NC)(c3ccc(OC)cn3)CC2)CC1 |
| InChI | InChI=1S/C22H32N4O3/c1-4-16-29-21(27)26-13-5-12-25(14-15-26)18-8-10-22(23-2,11-9-18)20-7-6-19(28-3)17-24-20/h1,6-7,17-18,23H,5,8-16H2,2-3H3 |
| InChIKey | CKGJQPNANASCNS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|