C19H20F2N2O — CID 134441971
N-[3-(3-amino-2,4-difluorophenyl)-4-methylphenyl]-2,2-dimethylcyclopropane-1-carboxamide (PubChem CID 134441971) has the molecular formula C19H20F2N2O and a molecular weight of 330.38 g/mol. Its IUPAC name is N-[3-(3-amino-2,4-difluorophenyl)-4-methylphenyl]-2,2-dimethylcyclopropane-1-carboxamide.
| Compound Name | N-[3-(3-amino-2,4-difluorophenyl)-4-methylphenyl]-2,2-dimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 134441971 |
| Molecular Formula | C19H20F2N2O |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N-[3-(3-amino-2,4-difluorophenyl)-4-methylphenyl]-2,2-dimethylcyclopropane-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CC2(C)C)cc1-c1ccc(F)c(N)c1F |
| InChI | InChI=1S/C19H20F2N2O/c1-10-4-5-11(23-18(24)14-9-19(14,2)3)8-13(10)12-6-7-15(20)17(22)16(12)21/h4-8,14H,9,22H2,1-3H3,(H,23,24) |
| InChIKey | QPUFGTFXUGDYJV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|