C19H19ClF3NO2 — CID 134442918
ethyl 2-chloro-1-cyclopentyl-5-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxylate (PubChem CID 134442918) has the molecular formula C19H19ClF3NO2 and a molecular weight of 385.81 g/mol. Its IUPAC name is ethyl 2-chloro-1-cyclopentyl-5-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxylate.
| Compound Name | ethyl 2-chloro-1-cyclopentyl-5-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 134442918 |
| Molecular Formula | C19H19ClF3NO2 |
| Molecular Weight | 385.81 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | ethyl 2-chloro-1-cyclopentyl-5-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2C(F)(F)F)n(C2CCCC2)c1Cl |
| InChI | InChI=1S/C19H19ClF3NO2/c1-2-26-18(25)14-11-16(24(17(14)20)12-7-3-4-8-12)13-9-5-6-10-15(13)19(21,22)23/h5-6,9-12H,2-4,7-8H2,1H3 |
| InChIKey | XQJAHAIYZPJYQF-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.81 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |