C26H26N4O2 — CID 134445691
N-[3-[5-(benzylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]-3-methyl-2-oxopentanamide (PubChem CID 134445691) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[3-[5-(benzylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]-3-methyl-2-oxopentanamide.
| Compound Name | N-[3-[5-(benzylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]-3-methyl-2-oxopentanamide |
|---|---|
| PubChem CID | 134445691 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | N-[3-[5-(benzylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]-3-methyl-2-oxopentanamide |
| SMILES | CCC(C)C(=O)C(=O)Nc1cccc(-c2c[nH]c3ncc(NCc4ccccc4)cc23)c1 |
| InChI | InChI=1S/C26H26N4O2/c1-3-17(2)24(31)26(32)30-20-11-7-10-19(12-20)23-16-29-25-22(23)13-21(15-28-25)27-14-18-8-5-4-6-9-18/h4-13,15-17,27H,3,14H2,1-2H3,(H,28,29)(H,30,32) |
| InChIKey | NAUGLAWNPWYXMT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|